C30H27N3O5S — CID 3517371
diethyl 2-[[[4-phenyl-5-[(4-phenylphenyl)carbamoyl]-1,3-thiazol-2-yl]amino]methylidene]propanedioate (PubChem CID 3517371) has the molecular formula C30H27N3O5S and a molecular weight of 541.63 g/mol. Its IUPAC name is diethyl 2-[[[4-phenyl-5-[(4-phenylphenyl)carbamoyl]-1,3-thiazol-2-yl]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[4-phenyl-5-[(4-phenylphenyl)carbamoyl]-1,3-thiazol-2-yl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 3517371 |
| Molecular Formula | C30H27N3O5S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | diethyl 2-[[[4-phenyl-5-[(4-phenylphenyl)carbamoyl]-1,3-thiazol-2-yl]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1nc(-c2ccccc2)c(C(=O)Nc2ccc(-c3ccccc3)cc2)s1)C(=O)OCC |
| InChI | InChI=1S/C30H27N3O5S/c1-3-37-28(35)24(29(36)38-4-2)19-31-30-33-25(22-13-9-6-10-14-22)26(39-30)27(34)32-23-17-15-21(16-18-23)20-11-7-5-8-12-20/h5-19H,3-4H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | BPPLSUQAGWVGSC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|