C24H17FN6O3S — CID 21366491
1-(6-fluoronaphthalen-2-yl)-N-[4-(2-sulfamoylphenyl)phenyl]tetrazole-5-carboxamide (PubChem CID 21366491) has the molecular formula C24H17FN6O3S and a molecular weight of 488.50 g/mol. Its IUPAC name is 1-(6-fluoronaphthalen-2-yl)-N-[4-(2-sulfamoylphenyl)phenyl]tetrazole-5-carboxamide.
| Compound Name | 1-(6-fluoronaphthalen-2-yl)-N-[4-(2-sulfamoylphenyl)phenyl]tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 21366491 |
| Molecular Formula | C24H17FN6O3S |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 1-(6-fluoronaphthalen-2-yl)-N-[4-(2-sulfamoylphenyl)phenyl]tetrazole-5-carboxamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc(NC(=O)c2nnnn2-c2ccc3cc(F)ccc3c2)cc1 |
| InChI | InChI=1S/C24H17FN6O3S/c25-18-9-5-17-14-20(12-8-16(17)13-18)31-23(28-29-30-31)24(32)27-19-10-6-15(7-11-19)21-3-1-2-4-22(21)35(26,33)34/h1-14H,(H,27,32)(H2,26,33,34) |
| InChIKey | DEOXQLPIAQLIQK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |