C20H13Cl2IN4O3S2 — CID 91544023
N-[(2,6-dichlorophenyl)methyl]-4-iodo-2-([1,2]thiazolo[4,5-c]pyridin-4-ylsulfonylamino)benzamide (PubChem CID 91544023) has the molecular formula C20H13Cl2IN4O3S2 and a molecular weight of 619.29 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-4-iodo-2-([1,2]thiazolo[4,5-c]pyridin-4-ylsulfonylamino)benzamide.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-4-iodo-2-([1,2]thiazolo[4,5-c]pyridin-4-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 91544023 |
| Molecular Formula | C20H13Cl2IN4O3S2 |
| Molecular Weight | 619.29 g/mol |
| Exact Mass | 617.89 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-4-iodo-2-([1,2]thiazolo[4,5-c]pyridin-4-ylsulfonylamino)benzamide |
| SMILES | O=C(NCc1c(Cl)cccc1Cl)c1ccc(I)cc1NS(=O)(=O)c1nccc2sncc12 |
| InChI | InChI=1S/C20H13Cl2IN4O3S2/c21-15-2-1-3-16(22)13(15)9-25-19(28)12-5-4-11(23)8-17(12)27-32(29,30)20-14-10-26-31-18(14)6-7-24-20/h1-8,10,27H,9H2,(H,25,28) |
| InChIKey | QPTLPNHQCJGHGC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|