C22H38O6Si — CID 91544420
methyl 2-[(2S)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-3-oxo-6-prop-2-enyloxan-4-ylidene]acetate (PubChem CID 91544420) has the molecular formula C22H38O6Si and a molecular weight of 426.63 g/mol. Its IUPAC name is methyl 2-[(2S)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-3-oxo-6-prop-2-enyloxan-4-ylidene]acetate.
| Compound Name | methyl 2-[(2S)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-3-oxo-6-prop-2-enyloxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 91544420 |
| Molecular Formula | C22H38O6Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | methyl 2-[(2S)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-3-oxo-6-prop-2-enyloxan-4-ylidene]acetate |
| SMILES | C=CCC1CC(=CC(=O)OC)C(=O)[C@](OC)(C(C)(C)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H38O6Si/c1-11-12-17-13-16(14-18(23)25-7)19(24)22(26-8,28-17)21(5,6)15-27-29(9,10)20(2,3)4/h11,14,17H,1,12-13,15H2,2-10H3/t17?,22-/m1/s1 |
| InChIKey | OHDLGTGTQKBCJG-IVAFLUGOSA-N |
| XLogP | 4.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|