C12H17N3 — CID 91549954
2,3,4,4a,5,6,6a,10a-octahydrobenzo[h]quinazolin-2-amine (PubChem CID 91549954) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 2,3,4,4a,5,6,6a,10a-octahydrobenzo[h]quinazolin-2-amine.
| Compound Name | 2,3,4,4a,5,6,6a,10a-octahydrobenzo[h]quinazolin-2-amine |
|---|---|
| PubChem CID | 91549954 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2,3,4,4a,5,6,6a,10a-octahydrobenzo[h]quinazolin-2-amine |
| SMILES | NC1N=C2C(CCC3C=CC=CC23)CN1 |
| InChI | InChI=1S/C12H17N3/c13-12-14-7-9-6-5-8-3-1-2-4-10(8)11(9)15-12/h1-4,8-10,12,14H,5-7,13H2 |
| InChIKey | CNNMLHBSQKUMSW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |