C12H16N2 — CID 91553534
2,3,4,4a,5,6,6a,10a-octahydrobenzo[h]quinazoline (PubChem CID 91553534) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2,3,4,4a,5,6,6a,10a-octahydrobenzo[h]quinazoline.
| Compound Name | 2,3,4,4a,5,6,6a,10a-octahydrobenzo[h]quinazoline |
|---|---|
| PubChem CID | 91553534 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2,3,4,4a,5,6,6a,10a-octahydrobenzo[h]quinazoline |
| SMILES | C1=CC2CCC3CNCN=C3C2C=C1 |
| InChI | InChI=1S/C12H16N2/c1-2-4-11-9(3-1)5-6-10-7-13-8-14-12(10)11/h1-4,9-11,13H,5-8H2 |
| InChIKey | RYIRPYLTOBYPGB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |