C21H18Br2N6O5S — CID 91550868
5-(4-bromophenyl)-4-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-6-[[furan-2-yl(methyl)sulfamoyl]amino]pyrimidine (PubChem CID 91550868) has the molecular formula C21H18Br2N6O5S and a molecular weight of 626.29 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-6-[[furan-2-yl(methyl)sulfamoyl]amino]pyrimidine.
| Compound Name | 5-(4-bromophenyl)-4-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-6-[[furan-2-yl(methyl)sulfamoyl]amino]pyrimidine |
|---|---|
| PubChem CID | 91550868 |
| Molecular Formula | C21H18Br2N6O5S |
| Molecular Weight | 626.29 g/mol |
| Exact Mass | 623.94 |
| IUPAC Name | 5-(4-bromophenyl)-4-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-6-[[furan-2-yl(methyl)sulfamoyl]amino]pyrimidine |
| SMILES | CN(c1ccco1)S(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H18Br2N6O5S/c1-29(17-3-2-8-32-17)35(30,31)28-19-18(14-4-6-15(22)7-5-14)20(27-13-26-19)33-9-10-34-21-24-11-16(23)12-25-21/h2-8,11-13H,9-10H2,1H3,(H,26,27,28) |
| InChIKey | LGFUPYWNJPMKKF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 132.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|