C26H31FN2O7 — CID 91551061
(3R,4S,5S,6R)-2-[[4-[[2-[(3-fluorophenyl)methoxy]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 91551061) has the molecular formula C26H31FN2O7 and a molecular weight of 502.54 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[[4-[[2-[(3-fluorophenyl)methoxy]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-[[4-[[2-[(3-fluorophenyl)methoxy]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 91551061 |
| Molecular Formula | C26H31FN2O7 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (3R,4S,5S,6R)-2-[[4-[[2-[(3-fluorophenyl)methoxy]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)c1[nH]nc(OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1Cc1ccccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C26H31FN2O7/c1-14(2)21-18(25(29-28-21)36-26-24(33)23(32)22(31)20(12-30)35-26)11-16-7-3-4-9-19(16)34-13-15-6-5-8-17(27)10-15/h3-10,14,20,22-24,26,30-33H,11-13H2,1-2H3,(H,28,29)/t20-,22-,23+,24-,26?/m1/s1 |
| InChIKey | BEBMRBAUZOTHLO-YDAXQGKVSA-N |
| XLogP | 2.02 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |