C20H25F3N2O6 — CID 71451518
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[5-propan-2-yl-4-[[2-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-yl]oxy]oxane-3,4,5-triol (PubChem CID 71451518) has the molecular formula C20H25F3N2O6 and a molecular weight of 446.42 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[5-propan-2-yl-4-[[2-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[5-propan-2-yl-4-[[2-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71451518 |
| Molecular Formula | C20H25F3N2O6 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[5-propan-2-yl-4-[[2-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-yl]oxy]oxane-3,4,5-triol |
| SMILES | CC(C)c1[nH]nc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H25F3N2O6/c1-9(2)14-11(7-10-5-3-4-6-12(10)20(21,22)23)18(25-24-14)31-19-17(29)16(28)15(27)13(8-26)30-19/h3-6,9,13,15-17,19,26-29H,7-8H2,1-2H3,(H,24,25)/t13-,15-,16+,17-,19+/m1/s1 |
| InChIKey | VESIRPJRGWDPGB-YRHQEJDOSA-N |
| XLogP | 1.32 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |