C19H19F3N2O6 — CID 87327776
(2R,3R,4S,5S,6R)-2-[[4-[(4-ethynylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 87327776) has the molecular formula C19H19F3N2O6 and a molecular weight of 428.36 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[[4-[(4-ethynylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[[4-[(4-ethynylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 87327776 |
| Molecular Formula | C19H19F3N2O6 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[4-[(4-ethynylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C#Cc1ccc(Cc2c(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)n[nH]c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F3N2O6/c1-2-9-3-5-10(6-4-9)7-11-16(19(20,21)22)23-24-17(11)30-18-15(28)14(27)13(26)12(8-25)29-18/h1,3-6,12-15,18,25-28H,7-8H2,(H,23,24)/t12-,13-,14+,15-,18-/m1/s1 |
| InChIKey | XQTJXNWANYZZGD-VPKNTQAGSA-N |
| XLogP | 0.18 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|