C24H31F3N2O6 — CID 10228778
(2S,3R,4S,5S,6R)-2-[1-cyclopentyl-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10228778) has the molecular formula C24H31F3N2O6 and a molecular weight of 500.51 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[1-cyclopentyl-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[1-cyclopentyl-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10228778 |
| Molecular Formula | C24H31F3N2O6 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[1-cyclopentyl-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)nn(C3CCCC3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H31F3N2O6/c1-2-13-7-9-14(10-8-13)11-16-21(24(25,26)27)29(15-5-3-4-6-15)28-22(16)35-23-20(33)19(32)18(31)17(12-30)34-23/h7-10,15,17-20,23,30-33H,2-6,11-12H2,1H3/t17-,18-,19+,20-,23+/m1/s1 |
| InChIKey | KGAQTJOOQCUEDL-MZSWFSNMSA-N |
| XLogP | 2.35 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |