C23H27F3N2O6 — CID 163664421
5-[1-cyclobutyl-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-5,6-diol (PubChem CID 163664421) has the molecular formula C23H27F3N2O6 and a molecular weight of 484.47 g/mol. Its IUPAC name is 5-[1-cyclobutyl-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-5,6-diol.
| Compound Name | 5-[1-cyclobutyl-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-5,6-diol |
|---|---|
| PubChem CID | 163664421 |
| Molecular Formula | C23H27F3N2O6 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 5-[1-cyclobutyl-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-5,6-diol |
| SMILES | CCc1ccc(Cc2c(OC3(O)COC(CO)C4OC43O)nn(C3CCC3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H27F3N2O6/c1-2-13-6-8-14(9-7-13)10-16-18(23(24,25)26)28(15-4-3-5-15)27-20(16)34-21(30)12-32-17(11-29)19-22(21,31)33-19/h6-9,15,17,19,29-31H,2-5,10-12H2,1H3 |
| InChIKey | IXEJKMRLCFFFME-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|