C24H30F4N2O7 — CID 89274227
(2S,3R,4S,5S,6S)-6-(hydroxymethyl)-5-methyl-2-[5-methyl-1-(oxolan-3-yl)-4-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]pyrazol-3-yl]oxyoxane-3,4-diol (PubChem CID 89274227) has the molecular formula C24H30F4N2O7 and a molecular weight of 534.50 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-6-(hydroxymethyl)-5-methyl-2-[5-methyl-1-(oxolan-3-yl)-4-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]pyrazol-3-yl]oxyoxane-3,4-diol.
| Compound Name | (2S,3R,4S,5S,6S)-6-(hydroxymethyl)-5-methyl-2-[5-methyl-1-(oxolan-3-yl)-4-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]pyrazol-3-yl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 89274227 |
| Molecular Formula | C24H30F4N2O7 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | (2S,3R,4S,5S,6S)-6-(hydroxymethyl)-5-methyl-2-[5-methyl-1-(oxolan-3-yl)-4-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]pyrazol-3-yl]oxyoxane-3,4-diol |
| SMILES | Cc1c(Cc2ccc(OC(F)(F)C(F)F)cc2)c(O[C@@H]2O[C@H](CO)[C@@H](C)[C@H](O)[C@H]2O)nn1C1CCOC1 |
| InChI | InChI=1S/C24H30F4N2O7/c1-12-18(10-31)35-22(20(33)19(12)32)36-21-17(13(2)30(29-21)15-7-8-34-11-15)9-14-3-5-16(6-4-14)37-24(27,28)23(25)26/h3-6,12,15,18-20,22-23,31-33H,7-11H2,1-2H3/t12-,15?,18-,19+,20-,22+/m1/s1 |
| InChIKey | BHBFEMFNRREVMI-ZHGJTHDPSA-N |
| XLogP | 2.43 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|