C26H35NO9 — CID 11341115
[(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrrol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate (PubChem CID 11341115) has the molecular formula C26H35NO9 and a molecular weight of 505.56 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrrol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrrol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate |
|---|---|
| PubChem CID | 11341115 |
| Molecular Formula | C26H35NO9 |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrrol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate |
| SMILES | CCc1ccc(Cc2c(O[C@@H]3O[C@H](COC(=O)OC)[C@@H](O)[C@H](O)[C@H]3O)cn(C3CCOC3)c2C)cc1 |
| InChI | InChI=1S/C26H35NO9/c1-4-16-5-7-17(8-6-16)11-19-15(2)27(18-9-10-33-13-18)12-20(19)35-25-24(30)23(29)22(28)21(36-25)14-34-26(31)32-3/h5-8,12,18,21-25,28-30H,4,9-11,13-14H2,1-3H3/t18?,21-,22-,23+,24-,25-/m1/s1 |
| InChIKey | XQQOPEMMIYKREN-IRVHACHESA-N |
| XLogP | 1.88 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |