C29H36N2O9 — CID 70904699
[(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-5-methylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2-hydroxyacetate (PubChem CID 70904699) has the molecular formula C29H36N2O9 and a molecular weight of 556.61 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-5-methylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2-hydroxyacetate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-5-methylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 70904699 |
| Molecular Formula | C29H36N2O9 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-5-methylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2-hydroxyacetate |
| SMILES | CCc1ccc(Cc2c(O[C@@H]3O[C@H](COC(=O)CO)[C@@H](O)[C@H](O)[C@H]3O)nn(Cc3ccc(OC)cc3)c2C)cc1 |
| InChI | InChI=1S/C29H36N2O9/c1-4-18-5-7-19(8-6-18)13-22-17(2)31(14-20-9-11-21(37-3)12-10-20)30-28(22)40-29-27(36)26(35)25(34)23(39-29)16-38-24(33)15-32/h5-12,23,25-27,29,32,34-36H,4,13-16H2,1-3H3/t23-,25-,26+,27-,29+/m1/s1 |
| InChIKey | KCNKKWKDUDPTES-LILOYGOGSA-N |
| XLogP | 1.12 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |