C23H32N2O9 — CID 91542285
methyl [(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[4-[(4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxyoxan-2-yl]methyl carbonate (PubChem CID 91542285) has the molecular formula C23H32N2O9 and a molecular weight of 480.51 g/mol. Its IUPAC name is methyl [(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[4-[(4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxyoxan-2-yl]methyl carbonate.
| Compound Name | methyl [(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[4-[(4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxyoxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 91542285 |
| Molecular Formula | C23H32N2O9 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | methyl [(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[4-[(4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxyoxan-2-yl]methyl carbonate |
| SMILES | COC(=O)OC[C@H]1OC(Oc2nn(C(C)C)c(C)c2Cc2ccc(OC)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H32N2O9/c1-12(2)25-13(3)16(10-14-6-8-15(30-4)9-7-14)21(24-25)34-22-20(28)19(27)18(26)17(33-22)11-32-23(29)31-5/h6-9,12,17-20,22,26-28H,10-11H2,1-5H3/t17-,18-,19+,20-,22?/m1/s1 |
| InChIKey | RFBHMIDLQJRZLV-GDFBDPINSA-N |
| XLogP | 1.34 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |