C24H34N2O9 — CID 23543162
[(2R,3S,4S,5R,6S)-6-[4-[(4-ethoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate (PubChem CID 23543162) has the molecular formula C24H34N2O9 and a molecular weight of 494.54 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[4-[(4-ethoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[4-[(4-ethoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate |
|---|---|
| PubChem CID | 23543162 |
| Molecular Formula | C24H34N2O9 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[4-[(4-ethoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate |
| SMILES | CCOc1ccc(Cc2c(O[C@@H]3O[C@H](COC(=O)OC)[C@@H](O)[C@H](O)[C@H]3O)nn(C(C)C)c2C)cc1 |
| InChI | InChI=1S/C24H34N2O9/c1-6-32-16-9-7-15(8-10-16)11-17-14(4)26(13(2)3)25-22(17)35-23-21(29)20(28)19(27)18(34-23)12-33-24(30)31-5/h7-10,13,18-21,23,27-29H,6,11-12H2,1-5H3/t18-,19-,20+,21-,23+/m1/s1 |
| InChIKey | CKIPBMVOIUQGHO-VZWAGXQNSA-N |
| XLogP | 1.73 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |