C26H36N2O9 — CID 59713376
ethyl [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl carbonate (PubChem CID 59713376) has the molecular formula C26H36N2O9 and a molecular weight of 520.58 g/mol. Its IUPAC name is ethyl [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl carbonate.
| Compound Name | ethyl [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 59713376 |
| Molecular Formula | C26H36N2O9 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | ethyl [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl carbonate |
| SMILES | CCOC(=O)OC[C@H]1O[C@@H](Oc2nn(C3CCOC3)c(C)c2Cc2ccc(CC)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H36N2O9/c1-4-16-6-8-17(9-7-16)12-19-15(3)28(18-10-11-33-13-18)27-24(19)37-25-23(31)22(30)21(29)20(36-25)14-35-26(32)34-5-2/h6-9,18,20-23,25,29-31H,4-5,10-14H2,1-3H3/t18?,20-,21-,22+,23-,25+/m1/s1 |
| InChIKey | ZPHTUWCMTMDFIC-LPIFMINDSA-N |
| XLogP | 1.67 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |