C33H49NO9 — CID 11433416
[(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrrol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl octyl carbonate (PubChem CID 11433416) has the molecular formula C33H49NO9 and a molecular weight of 603.75 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrrol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl octyl carbonate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrrol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl octyl carbonate |
|---|---|
| PubChem CID | 11433416 |
| Molecular Formula | C33H49NO9 |
| Molecular Weight | 603.75 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[4-[(4-ethylphenyl)methyl]-5-methyl-1-(oxolan-3-yl)pyrrol-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl octyl carbonate |
| SMILES | CCCCCCCCOC(=O)OC[C@H]1O[C@@H](Oc2cn(C3CCOC3)c(C)c2Cc2ccc(CC)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C33H49NO9/c1-4-6-7-8-9-10-16-40-33(38)41-21-28-29(35)30(36)31(37)32(43-28)42-27-19-34(25-15-17-39-20-25)22(3)26(27)18-24-13-11-23(5-2)12-14-24/h11-14,19,25,28-32,35-37H,4-10,15-18,20-21H2,1-3H3/t25?,28-,29-,30+,31-,32-/m1/s1 |
| InChIKey | BBAYJLHDSCWULJ-ASSZPPITSA-N |
| XLogP | 4.61 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.75 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|