C25H29NO8 — CID 11476955
[(2R,3S,4S,5R,6S)-6-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate (PubChem CID 11476955) has the molecular formula C25H29NO8 and a molecular weight of 471.51 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate |
|---|---|
| PubChem CID | 11476955 |
| Molecular Formula | C25H29NO8 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl methyl carbonate |
| SMILES | CCc1ccc(Cc2c[nH]c3cccc(O[C@@H]4O[C@H](COC(=O)OC)[C@@H](O)[C@H](O)[C@H]4O)c23)cc1 |
| InChI | InChI=1S/C25H29NO8/c1-3-14-7-9-15(10-8-14)11-16-12-26-17-5-4-6-18(20(16)17)33-24-23(29)22(28)21(27)19(34-24)13-32-25(30)31-2/h4-10,12,19,21-24,26-29H,3,11,13H2,1-2H3/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | WFUNLRHPNPCKTF-PFKOEMKTSA-N |
| XLogP | 2.29 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |