C23H27NO7 — CID 87470504
(2R,3R,4S,5S,6R)-3-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]peroxy]-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 87470504) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-3-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]peroxy]-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-3-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]peroxy]-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 87470504 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-3-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]peroxy]-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | CCc1ccc(Cc2c[nH]c3cccc(OO[C@@H]4[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]4O)c23)cc1 |
| InChI | InChI=1S/C23H27NO7/c1-2-13-6-8-14(9-7-13)10-15-11-24-16-4-3-5-17(19(15)16)30-31-22-21(27)20(26)18(12-25)29-23(22)28/h3-9,11,18,20-28H,2,10,12H2,1H3/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | JLSNOROAWRHQSR-DODNOZFWSA-N |
| XLogP | 1.43 |
| TPSA | 124.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|