C22H24ClNO6 — CID 71022668
(2S,3R,4S,5S,6R)-2-[[6-chloro-3-[(4-methylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71022668) has the molecular formula C22H24ClNO6 and a molecular weight of 433.89 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[[6-chloro-3-[(4-methylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[[6-chloro-3-[(4-methylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71022668 |
| Molecular Formula | C22H24ClNO6 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[[6-chloro-3-[(4-methylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1ccc(Cc2c[nH]c3cc(Cl)cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c23)cc1 |
| InChI | InChI=1S/C22H24ClNO6/c1-11-2-4-12(5-3-11)6-13-9-24-15-7-14(23)8-16(18(13)15)29-22-21(28)20(27)19(26)17(10-25)30-22/h2-5,7-9,17,19-22,24-28H,6,10H2,1H3/t17-,19-,20+,21-,22-/m1/s1 |
| InChIKey | SLTGVFOJPVPCBA-MIUGBVLSSA-N |
| XLogP | 1.90 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |