C22H24FNO7 — CID 91453405
(3S,4S,5S,6R)-3-[[3-[(3-fluoro-4-methylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 91453405) has the molecular formula C22H24FNO7 and a molecular weight of 433.43 g/mol. Its IUPAC name is (3S,4S,5S,6R)-3-[[3-[(3-fluoro-4-methylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3S,4S,5S,6R)-3-[[3-[(3-fluoro-4-methylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 91453405 |
| Molecular Formula | C22H24FNO7 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (3S,4S,5S,6R)-3-[[3-[(3-fluoro-4-methylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | Cc1ccc(Cc2c[nH]c3cccc(O[C@]4(O)C(O)O[C@H](CO)[C@@H](O)[C@@H]4O)c23)cc1F |
| InChI | InChI=1S/C22H24FNO7/c1-11-5-6-12(8-14(11)23)7-13-9-24-15-3-2-4-16(18(13)15)31-22(29)20(27)19(26)17(10-25)30-21(22)28/h2-6,8-9,17,19-21,24-29H,7,10H2,1H3/t17-,19-,20+,21?,22+/m1/s1 |
| InChIKey | ACFXOSCYQSVOGF-LAJURYSTSA-N |
| XLogP | 0.70 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|