C22H26N2O8 — CID 68633268
(2S,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[(4-methoxyphenyl)methyl]-6-methyl-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol (PubChem CID 68633268) has the molecular formula C22H26N2O8 and a molecular weight of 446.46 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[(4-methoxyphenyl)methyl]-6-methyl-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[(4-methoxyphenyl)methyl]-6-methyl-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 68633268 |
| Molecular Formula | C22H26N2O8 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (2S,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[(4-methoxyphenyl)methyl]-6-methyl-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol |
| SMILES | COc1ccc(Cc2[nH]nc3cc(C)cc(O[C@]4(O)[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]4O)c23)cc1 |
| InChI | InChI=1S/C22H26N2O8/c1-11-7-14-18(15(24-23-14)9-12-3-5-13(30-2)6-4-12)16(8-11)32-22(29)20(27)19(26)17(10-25)31-21(22)28/h3-8,17,19-21,25-29H,9-10H2,1-2H3,(H,23,24)/t17-,19-,20+,21+,22+/m1/s1 |
| InChIKey | DDXNPCDFKCTWON-ICGSVKGVSA-N |
| XLogP | -0.03 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|