C22H27N3O7 — CID 69005219
(2R,3S,4S,5S,6R)-3-[3-[(4-ethylphenyl)methyl]-6-methylbenzotriazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 69005219) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-3-[3-[(4-ethylphenyl)methyl]-6-methylbenzotriazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4S,5S,6R)-3-[3-[(4-ethylphenyl)methyl]-6-methylbenzotriazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 69005219 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (2R,3S,4S,5S,6R)-3-[3-[(4-ethylphenyl)methyl]-6-methylbenzotriazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | CCc1ccc(Cn2nnc3cc(C)cc(O[C@]4(O)[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]4O)c32)cc1 |
| InChI | InChI=1S/C22H27N3O7/c1-3-13-4-6-14(7-5-13)10-25-18-15(23-24-25)8-12(2)9-16(18)32-22(30)20(28)19(27)17(11-26)31-21(22)29/h4-9,17,19-21,26-30H,3,10-11H2,1-2H3/t17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | ICMBKUBUCPOUDI-VOFPXKNKSA-N |
| XLogP | -0.15 |
| TPSA | 150.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|