C24H29N3O9 — CID 69004418
ethyl [(2R,3S,4S,5S,6R)-5-[3-[(4-ethylphenyl)methyl]benzotriazol-4-yl]oxy-3,4,5,6-tetrahydroxyoxan-2-yl]methyl carbonate (PubChem CID 69004418) has the molecular formula C24H29N3O9 and a molecular weight of 503.51 g/mol. Its IUPAC name is ethyl [(2R,3S,4S,5S,6R)-5-[3-[(4-ethylphenyl)methyl]benzotriazol-4-yl]oxy-3,4,5,6-tetrahydroxyoxan-2-yl]methyl carbonate.
| Compound Name | ethyl [(2R,3S,4S,5S,6R)-5-[3-[(4-ethylphenyl)methyl]benzotriazol-4-yl]oxy-3,4,5,6-tetrahydroxyoxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 69004418 |
| Molecular Formula | C24H29N3O9 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | ethyl [(2R,3S,4S,5S,6R)-5-[3-[(4-ethylphenyl)methyl]benzotriazol-4-yl]oxy-3,4,5,6-tetrahydroxyoxan-2-yl]methyl carbonate |
| SMILES | CCOC(=O)OC[C@H]1O[C@@H](O)[C@@](O)(Oc2cccc3nnn(Cc4ccc(CC)cc4)c23)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29N3O9/c1-3-14-8-10-15(11-9-14)12-27-19-16(25-26-27)6-5-7-17(19)36-24(32)21(29)20(28)18(35-22(24)30)13-34-23(31)33-4-2/h5-11,18,20-22,28-30,32H,3-4,12-13H2,1-2H3/t18-,20-,21+,22-,24+/m1/s1 |
| InChIKey | HVAABEFUYKHEHI-YVTYUBGGSA-N |
| XLogP | 0.72 |
| TPSA | 165.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|