C21H25N3O8 — CID 69007333
(2R,3S,4S,5S,6R)-3-[3-[(4-ethoxyphenyl)methyl]benzotriazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 69007333) has the molecular formula C21H25N3O8 and a molecular weight of 447.44 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-3-[3-[(4-ethoxyphenyl)methyl]benzotriazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4S,5S,6R)-3-[3-[(4-ethoxyphenyl)methyl]benzotriazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 69007333 |
| Molecular Formula | C21H25N3O8 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (2R,3S,4S,5S,6R)-3-[3-[(4-ethoxyphenyl)methyl]benzotriazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | CCOc1ccc(Cn2nnc3cccc(O[C@]4(O)[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]4O)c32)cc1 |
| InChI | InChI=1S/C21H25N3O8/c1-2-30-13-8-6-12(7-9-13)10-24-17-14(22-23-24)4-3-5-15(17)32-21(29)19(27)18(26)16(11-25)31-20(21)28/h3-9,16,18-20,25-29H,2,10-11H2,1H3/t16-,18-,19+,20-,21+/m1/s1 |
| InChIKey | GLEQFEPHBBTBOF-RQXATKFSSA-N |
| XLogP | -0.62 |
| TPSA | 159.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|