C22H26N2O5 — CID 11326994
(2S,3R,4R,5S,6R)-2-[3-[(4-ethylphenyl)methyl]benzimidazol-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 11326994) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(4-ethylphenyl)methyl]benzimidazol-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethylphenyl)methyl]benzimidazol-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11326994 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethylphenyl)methyl]benzimidazol-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cn2cnc3cccc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c32)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-2-13-6-8-14(9-7-13)10-24-12-23-16-5-3-4-15(18(16)24)22-21(28)20(27)19(26)17(11-25)29-22/h3-9,12,17,19-22,25-28H,2,10-11H2,1H3/t17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | PZAHDCKYENQUIM-VOFPXKNKSA-N |
| XLogP | 1.16 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |