C24H24N2O7S — CID 87523182
(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[3-[(4-thiophen-3-ylphenyl)methyl]benzimidazol-4-yl]peroxyoxane-2,4,5-triol (PubChem CID 87523182) has the molecular formula C24H24N2O7S and a molecular weight of 484.53 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[3-[(4-thiophen-3-ylphenyl)methyl]benzimidazol-4-yl]peroxyoxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[3-[(4-thiophen-3-ylphenyl)methyl]benzimidazol-4-yl]peroxyoxane-2,4,5-triol |
|---|---|
| PubChem CID | 87523182 |
| Molecular Formula | C24H24N2O7S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[3-[(4-thiophen-3-ylphenyl)methyl]benzimidazol-4-yl]peroxyoxane-2,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](O)[C@H](OOc2cccc3ncn(Cc4ccc(-c5ccsc5)cc4)c23)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H24N2O7S/c27-11-19-21(28)22(29)23(24(30)31-19)33-32-18-3-1-2-17-20(18)26(13-25-17)10-14-4-6-15(7-5-14)16-8-9-34-12-16/h1-9,12-13,19,21-24,27-30H,10-11H2/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | IUDZZIWXEJKQRO-PFKOEMKTSA-N |
| XLogP | 1.92 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|