C22H26N2O7 — CID 69038186
(2R,3R,4R,5R,6S)-3-[3-[(4-ethylphenyl)methyl]benzimidazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 69038186) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-3-[3-[(4-ethylphenyl)methyl]benzimidazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5R,6S)-3-[3-[(4-ethylphenyl)methyl]benzimidazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 69038186 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (2R,3R,4R,5R,6S)-3-[3-[(4-ethylphenyl)methyl]benzimidazol-4-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | CCc1ccc(Cn2cnc3cccc(O[C@@]4(O)[C@H](O)O[C@@H](CO)[C@H](O)[C@H]4O)c32)cc1 |
| InChI | InChI=1S/C22H26N2O7/c1-2-13-6-8-14(9-7-13)10-24-12-23-15-4-3-5-16(18(15)24)31-22(29)20(27)19(26)17(11-25)30-21(22)28/h3-9,12,17,19-21,25-29H,2,10-11H2,1H3/t17-,19-,20+,21+,22+/m0/s1 |
| InChIKey | UCPBEDWGQQNUNY-XBJCXQGOSA-N |
| XLogP | 0.15 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|