C21H24N2O8S — CID 68632321
(2R,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[(4-methoxyphenyl)sulfanylmethyl]-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol (PubChem CID 68632321) has the molecular formula C21H24N2O8S and a molecular weight of 464.50 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[(4-methoxyphenyl)sulfanylmethyl]-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[(4-methoxyphenyl)sulfanylmethyl]-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 68632321 |
| Molecular Formula | C21H24N2O8S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (2R,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[(4-methoxyphenyl)sulfanylmethyl]-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol |
| SMILES | COc1ccc(SCc2[nH]nc3cccc(O[C@]4(O)[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]4O)c23)cc1 |
| InChI | InChI=1S/C21H24N2O8S/c1-29-11-5-7-12(8-6-11)32-10-14-17-13(22-23-14)3-2-4-15(17)31-21(28)19(26)18(25)16(9-24)30-20(21)27/h2-8,16,18-20,24-28H,9-10H2,1H3,(H,22,23)/t16-,18-,19+,20-,21+/m1/s1 |
| InChIKey | ZHRZULYIERANST-RQXATKFSSA-N |
| XLogP | 0.36 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|