C23H28N2O8 — CID 87523632
(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[2-(4-methoxyphenyl)ethyl]-6-methyl-2H-indazol-4-yl]peroxy]oxane-2,4,5-triol (PubChem CID 87523632) has the molecular formula C23H28N2O8 and a molecular weight of 460.48 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[2-(4-methoxyphenyl)ethyl]-6-methyl-2H-indazol-4-yl]peroxy]oxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[2-(4-methoxyphenyl)ethyl]-6-methyl-2H-indazol-4-yl]peroxy]oxane-2,4,5-triol |
|---|---|
| PubChem CID | 87523632 |
| Molecular Formula | C23H28N2O8 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[[3-[2-(4-methoxyphenyl)ethyl]-6-methyl-2H-indazol-4-yl]peroxy]oxane-2,4,5-triol |
| SMILES | COc1ccc(CCc2[nH]nc3cc(C)cc(OO[C@@H]4[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]4O)c23)cc1 |
| InChI | InChI=1S/C23H28N2O8/c1-12-9-16-19(15(24-25-16)8-5-13-3-6-14(30-2)7-4-13)17(10-12)32-33-22-21(28)20(27)18(11-26)31-23(22)29/h3-4,6-7,9-10,18,20-23,26-29H,5,8,11H2,1-2H3,(H,24,25)/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | SJMRTKLTZXCQOC-DODNOZFWSA-N |
| XLogP | 0.78 |
| TPSA | 146.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|