C27H34N2O7 — CID 23543183
2-(hydroxymethyl)-6-[[3-[2-(6-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-6-methyl-2H-indazol-4-yl]oxy]oxane-3,4,5-triol (PubChem CID 23543183) has the molecular formula C27H34N2O7 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[[3-[2-(6-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-6-methyl-2H-indazol-4-yl]oxy]oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[[3-[2-(6-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-6-methyl-2H-indazol-4-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 23543183 |
| Molecular Formula | C27H34N2O7 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 2-(hydroxymethyl)-6-[[3-[2-(6-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-6-methyl-2H-indazol-4-yl]oxy]oxane-3,4,5-triol |
| SMILES | COC1CCc2cc(CCc3[nH]nc4cc(C)cc(OC5OC(CO)C(O)C(O)C5O)c34)ccc2C1 |
| InChI | InChI=1S/C27H34N2O7/c1-14-9-20-23(21(10-14)35-27-26(33)25(32)24(31)22(13-30)36-27)19(28-29-20)8-4-15-3-5-17-12-18(34-2)7-6-16(17)11-15/h3,5,9-11,18,22,24-27,30-33H,4,6-8,12-13H2,1-2H3,(H,28,29) |
| InChIKey | DKAVKSVFOKUFTF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |