C26H28N2O9 — CID 68630884
[(2R,3S,4S,5S,6S)-5-[[3-[2-(1-benzofuran-5-yl)ethyl]-6-methyl-2H-indazol-4-yl]oxy]-3,4,5,6-tetrahydroxyoxan-2-yl]methyl acetate (PubChem CID 68630884) has the molecular formula C26H28N2O9 and a molecular weight of 512.52 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6S)-5-[[3-[2-(1-benzofuran-5-yl)ethyl]-6-methyl-2H-indazol-4-yl]oxy]-3,4,5,6-tetrahydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5S,6S)-5-[[3-[2-(1-benzofuran-5-yl)ethyl]-6-methyl-2H-indazol-4-yl]oxy]-3,4,5,6-tetrahydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68630884 |
| Molecular Formula | C26H28N2O9 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | [(2R,3S,4S,5S,6S)-5-[[3-[2-(1-benzofuran-5-yl)ethyl]-6-methyl-2H-indazol-4-yl]oxy]-3,4,5,6-tetrahydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O)[C@@](O)(Oc2cc(C)cc3n[nH]c(CCc4ccc5occc5c4)c23)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H28N2O9/c1-13-9-18-22(17(27-28-18)5-3-15-4-6-19-16(11-15)7-8-34-19)20(10-13)37-26(33)24(31)23(30)21(36-25(26)32)12-35-14(2)29/h4,6-11,21,23-25,30-33H,3,5,12H2,1-2H3,(H,27,28)/t21-,23-,24+,25+,26+/m1/s1 |
| InChIKey | FSHYTQVKXNGRSZ-MQNYBYKRSA-N |
| XLogP | 1.47 |
| TPSA | 167.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|