C26H28O11 — CID 57030361
methyl (3S,4R,5S,6R)-5-[2-[3-(1-benzofuran-5-yl)propanoyl]-3-hydroxy-5-methylphenoxy]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-3-carboxylate (PubChem CID 57030361) has the molecular formula C26H28O11 and a molecular weight of 516.50 g/mol. Its IUPAC name is methyl (3S,4R,5S,6R)-5-[2-[3-(1-benzofuran-5-yl)propanoyl]-3-hydroxy-5-methylphenoxy]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-3-carboxylate.
| Compound Name | methyl (3S,4R,5S,6R)-5-[2-[3-(1-benzofuran-5-yl)propanoyl]-3-hydroxy-5-methylphenoxy]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-3-carboxylate |
|---|---|
| PubChem CID | 57030361 |
| Molecular Formula | C26H28O11 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | methyl (3S,4R,5S,6R)-5-[2-[3-(1-benzofuran-5-yl)propanoyl]-3-hydroxy-5-methylphenoxy]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-3-carboxylate |
| SMILES | COC(=O)[C@]1(O)CO[C@H](CO)[C@@](O)(Oc2cc(C)cc(O)c2C(=O)CCc2ccc3occc3c2)[C@@H]1O |
| InChI | InChI=1S/C26H28O11/c1-14-9-18(29)22(17(28)5-3-15-4-6-19-16(11-15)7-8-35-19)20(10-14)37-26(33)21(12-27)36-13-25(32,23(26)30)24(31)34-2/h4,6-11,21,23,27,29-30,32-33H,3,5,12-13H2,1-2H3/t21-,23-,25+,26-/m1/s1 |
| InChIKey | GKFWWJCUFAXCTN-VBSYDLGNSA-N |
| XLogP | 0.99 |
| TPSA | 176.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|