C24H30O9 — CID 53260591
1-[2,6-dihydroxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyphenyl]-3-(4-methoxy-3-methylphenyl)propan-1-one (PubChem CID 53260591) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is 1-[2,6-dihydroxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyphenyl]-3-(4-methoxy-3-methylphenyl)propan-1-one.
| Compound Name | 1-[2,6-dihydroxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyphenyl]-3-(4-methoxy-3-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 53260591 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 1-[2,6-dihydroxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyphenyl]-3-(4-methoxy-3-methylphenyl)propan-1-one |
| SMILES | COc1ccc(CCC(=O)c2c(O)cc(OC3C[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2O)cc1C |
| InChI | InChI=1S/C24H30O9/c1-12-7-13(4-6-19(12)32-2)3-5-16(26)21-17(27)9-15(10-18(21)28)33-20-8-14(11-25)22(29)24(31)23(20)30/h4,6-7,9-10,14,20,22-25,27-31H,3,5,8,11H2,1-2H3/t14-,20?,22-,23+,24+/m1/s1 |
| InChIKey | QLWHUEZHDZKDCJ-SUTURRMZSA-N |
| XLogP | 1.07 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |