C23H28O9 — CID 53260589
1-[2,6-dihydroxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyphenyl]-3-(4-hydroxy-3-methylphenyl)propan-1-one (PubChem CID 53260589) has the molecular formula C23H28O9 and a molecular weight of 448.47 g/mol. Its IUPAC name is 1-[2,6-dihydroxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyphenyl]-3-(4-hydroxy-3-methylphenyl)propan-1-one.
| Compound Name | 1-[2,6-dihydroxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyphenyl]-3-(4-hydroxy-3-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 53260589 |
| Molecular Formula | C23H28O9 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 1-[2,6-dihydroxy-4-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyphenyl]-3-(4-hydroxy-3-methylphenyl)propan-1-one |
| SMILES | Cc1cc(CCC(=O)c2c(O)cc(OC3C[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2O)ccc1O |
| InChI | InChI=1S/C23H28O9/c1-11-6-12(2-4-15(11)25)3-5-16(26)20-17(27)8-14(9-18(20)28)32-19-7-13(10-24)21(29)23(31)22(19)30/h2,4,6,8-9,13,19,21-25,27-31H,3,5,7,10H2,1H3/t13-,19?,21-,22+,23+/m1/s1 |
| InChIKey | GTULDRJJWDXZKP-KNNJHCBLSA-N |
| XLogP | 0.77 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |