C22H22O8 — CID 58212199
5-hydroxy-2-phenyl-7-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one (PubChem CID 58212199) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is 5-hydroxy-2-phenyl-7-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one.
| Compound Name | 5-hydroxy-2-phenyl-7-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one |
|---|---|
| PubChem CID | 58212199 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 5-hydroxy-2-phenyl-7-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(O[C@@H]3C[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c12 |
| InChI | InChI=1S/C22H22O8/c23-10-12-6-18(21(27)22(28)20(12)26)29-13-7-14(24)19-15(25)9-16(30-17(19)8-13)11-4-2-1-3-5-11/h1-5,7-9,12,18,20-24,26-28H,6,10H2/t12-,18-,20-,21+,22+/m1/s1 |
| InChIKey | SSCKBXBPQOLIAS-USXCBXDZSA-N |
| XLogP | 1.01 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |