C23H24O8 — CID 58212198
5-hydroxy-2-(4-methylphenyl)-7-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one (PubChem CID 58212198) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is 5-hydroxy-2-(4-methylphenyl)-7-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one.
| Compound Name | 5-hydroxy-2-(4-methylphenyl)-7-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one |
|---|---|
| PubChem CID | 58212198 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 5-hydroxy-2-(4-methylphenyl)-7-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxychromen-4-one |
| SMILES | Cc1ccc(-c2cc(=O)c3c(O)cc(O[C@@H]4C[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc3o2)cc1 |
| InChI | InChI=1S/C23H24O8/c1-11-2-4-12(5-3-11)17-9-16(26)20-15(25)7-14(8-18(20)31-17)30-19-6-13(10-24)21(27)23(29)22(19)28/h2-5,7-9,13,19,21-25,27-29H,6,10H2,1H3/t13-,19-,21-,22+,23+/m1/s1 |
| InChIKey | KXWWWBHVVNGWBA-OJVSQIECSA-N |
| XLogP | 1.32 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |