C25H34N2O6 — CID 89204221
(2S,3R,4S,5S,6R)-2-[4-[(4-ethynylphenyl)methyl]-1-hexan-3-yl-5-methylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89204221) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-[(4-ethynylphenyl)methyl]-1-hexan-3-yl-5-methylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-[(4-ethynylphenyl)methyl]-1-hexan-3-yl-5-methylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89204221 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-[(4-ethynylphenyl)methyl]-1-hexan-3-yl-5-methylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C#Cc1ccc(Cc2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)nn(C(CC)CCC)c2C)cc1 |
| InChI | InChI=1S/C25H34N2O6/c1-5-8-18(7-3)27-15(4)19(13-17-11-9-16(6-2)10-12-17)24(26-27)33-25-23(31)22(30)21(29)20(14-28)32-25/h2,9-12,18,20-23,25,28-31H,5,7-8,13-14H2,1,3-4H3/t18?,20-,21-,22+,23-,25+/m1/s1 |
| InChIKey | FXVIWYOYQZNBFJ-LPIFMINDSA-N |
| XLogP | 1.69 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|