C22H31FN2O6 — CID 142139353
(3S,4S,5R,6S)-2-ethyl-6-[4-[(3-fluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxyoxane-3,4,5-triol (PubChem CID 142139353) has the molecular formula C22H31FN2O6 and a molecular weight of 438.50 g/mol. Its IUPAC name is (3S,4S,5R,6S)-2-ethyl-6-[4-[(3-fluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (3S,4S,5R,6S)-2-ethyl-6-[4-[(3-fluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 142139353 |
| Molecular Formula | C22H31FN2O6 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (3S,4S,5R,6S)-2-ethyl-6-[4-[(3-fluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxyoxane-3,4,5-triol |
| SMILES | CCC1O[C@@H](Oc2nn(C(C)C)c(C)c2Cc2ccc(OC)c(F)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H31FN2O6/c1-6-16-18(26)19(27)20(28)22(30-16)31-21-14(12(4)25(24-21)11(2)3)9-13-7-8-17(29-5)15(23)10-13/h7-8,10-11,16,18-20,22,26-28H,6,9H2,1-5H3/t16?,18-,19+,20-,22+/m1/s1 |
| InChIKey | NDQSZCQSROSTMY-JZLTWYBRSA-N |
| XLogP | 2.11 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |