C23H29FO7 — CID 68984374
(2S,3R,4S,5S,6R)-2-[2-[(3-fluoro-4-methoxyphenyl)methyl]-3,5-dimethylphenoxy]-6-[(1R)-1-hydroxyethyl]oxane-3,4,5-triol (PubChem CID 68984374) has the molecular formula C23H29FO7 and a molecular weight of 436.48 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[2-[(3-fluoro-4-methoxyphenyl)methyl]-3,5-dimethylphenoxy]-6-[(1R)-1-hydroxyethyl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[2-[(3-fluoro-4-methoxyphenyl)methyl]-3,5-dimethylphenoxy]-6-[(1R)-1-hydroxyethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 68984374 |
| Molecular Formula | C23H29FO7 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[2-[(3-fluoro-4-methoxyphenyl)methyl]-3,5-dimethylphenoxy]-6-[(1R)-1-hydroxyethyl]oxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2c(C)cc(C)cc2O[C@@H]2O[C@H]([C@@H](C)O)[C@@H](O)[C@H](O)[C@H]2O)cc1F |
| InChI | InChI=1S/C23H29FO7/c1-11-7-12(2)15(9-14-5-6-17(29-4)16(24)10-14)18(8-11)30-23-21(28)19(26)20(27)22(31-23)13(3)25/h5-8,10,13,19-23,25-28H,9H2,1-4H3/t13-,19+,20+,21-,22-,23-/m1/s1 |
| InChIKey | DLLSMEMTNOZUTR-ZOTRNDTNSA-N |
| XLogP | 1.61 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |