C22H27ClO8 — CID 68984223
(2S,3R,4S,5S,6R)-2-[3-chloro-5-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]phenoxy]-6-[(1R)-1-hydroxyethyl]oxane-3,4,5-triol (PubChem CID 68984223) has the molecular formula C22H27ClO8 and a molecular weight of 454.90 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[3-chloro-5-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]phenoxy]-6-[(1R)-1-hydroxyethyl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[3-chloro-5-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]phenoxy]-6-[(1R)-1-hydroxyethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 68984223 |
| Molecular Formula | C22H27ClO8 |
| Molecular Weight | 454.90 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[3-chloro-5-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]phenoxy]-6-[(1R)-1-hydroxyethyl]oxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2c(Cl)cc(CO)cc2O[C@@H]2O[C@H]([C@@H](C)O)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H27ClO8/c1-11(25)21-19(27)18(26)20(28)22(31-21)30-17-9-13(10-24)8-16(23)15(17)7-12-3-5-14(29-2)6-4-12/h3-6,8-9,11,18-22,24-28H,7,10H2,1-2H3/t11-,18+,19+,20-,21-,22-/m1/s1 |
| InChIKey | HMGSCRCLUUGRRM-KHDLMLPYSA-N |
| XLogP | 1.00 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.90 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |