C28H33FO12 — CID 68985644
[3-fluoro-4-[(4-methoxyphenyl)methyl]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]oxyphenyl]methyl 2-prop-2-enoxycarbonyloxyacetate (PubChem CID 68985644) has the molecular formula C28H33FO12 and a molecular weight of 580.56 g/mol. Its IUPAC name is [3-fluoro-4-[(4-methoxyphenyl)methyl]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]oxyphenyl]methyl 2-prop-2-enoxycarbonyloxyacetate.
| Compound Name | [3-fluoro-4-[(4-methoxyphenyl)methyl]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]oxyphenyl]methyl 2-prop-2-enoxycarbonyloxyacetate |
|---|---|
| PubChem CID | 68985644 |
| Molecular Formula | C28H33FO12 |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | [3-fluoro-4-[(4-methoxyphenyl)methyl]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]oxyphenyl]methyl 2-prop-2-enoxycarbonyloxyacetate |
| SMILES | C=CCOC(=O)OCC(=O)OCc1cc(F)c(Cc2ccc(OC)cc2)c(O[C@@H]2O[C@H]([C@@H](C)O)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C28H33FO12/c1-4-9-37-28(35)39-14-22(31)38-13-17-11-20(29)19(10-16-5-7-18(36-3)8-6-16)21(12-17)40-27-25(34)23(32)24(33)26(41-27)15(2)30/h4-8,11-12,15,23-27,30,32-34H,1,9-10,13-14H2,2-3H3/t15-,23+,24+,25-,26-,27-/m1/s1 |
| InChIKey | LMXOOHWKZOMACB-OTZPCTTNSA-N |
| XLogP | 1.37 |
| TPSA | 170.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|