C24H29FO8 — CID 68984912
(2R,3R,4S,5S,6R)-2-[2-[(4-cyclopropyloxyphenyl)methyl]-3-fluoro-5-(hydroxymethyl)phenyl]-6-[(1S)-1-hydroxyethyl]oxane-2,3,4,5-tetrol (PubChem CID 68984912) has the molecular formula C24H29FO8 and a molecular weight of 464.49 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[2-[(4-cyclopropyloxyphenyl)methyl]-3-fluoro-5-(hydroxymethyl)phenyl]-6-[(1S)-1-hydroxyethyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[2-[(4-cyclopropyloxyphenyl)methyl]-3-fluoro-5-(hydroxymethyl)phenyl]-6-[(1S)-1-hydroxyethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 68984912 |
| Molecular Formula | C24H29FO8 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[2-[(4-cyclopropyloxyphenyl)methyl]-3-fluoro-5-(hydroxymethyl)phenyl]-6-[(1S)-1-hydroxyethyl]oxane-2,3,4,5-tetrol |
| SMILES | C[C@H](O)[C@H]1O[C@](O)(c2cc(CO)cc(F)c2Cc2ccc(OC3CC3)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29FO8/c1-12(27)22-20(28)21(29)23(30)24(31,33-22)18-9-14(11-26)10-19(25)17(18)8-13-2-4-15(5-3-13)32-16-6-7-16/h2-5,9-10,12,16,20-23,26-31H,6-8,11H2,1H3/t12-,20-,21-,22+,23+,24+/m0/s1 |
| InChIKey | AUCVFUDNFDIABS-BEGNFAQUSA-N |
| XLogP | 0.46 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |