C52H45FO13 — CID 68991155
[(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-3-fluoro-2-[(4-methoxyphenyl)methyl]phenyl]-4,5-dibenzoyloxy-2-[(1S)-1-benzoyloxyethyl]-6-hydroxyoxan-3-yl] benzoate (PubChem CID 68991155) has the molecular formula C52H45FO13 and a molecular weight of 896.92 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-3-fluoro-2-[(4-methoxyphenyl)methyl]phenyl]-4,5-dibenzoyloxy-2-[(1S)-1-benzoyloxyethyl]-6-hydroxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-3-fluoro-2-[(4-methoxyphenyl)methyl]phenyl]-4,5-dibenzoyloxy-2-[(1S)-1-benzoyloxyethyl]-6-hydroxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 68991155 |
| Molecular Formula | C52H45FO13 |
| Molecular Weight | 896.92 g/mol |
| Exact Mass | 896.28 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-3-fluoro-2-[(4-methoxyphenyl)methyl]phenyl]-4,5-dibenzoyloxy-2-[(1S)-1-benzoyloxyethyl]-6-hydroxyoxan-3-yl] benzoate |
| SMILES | COc1ccc(Cc2c(F)cc(COC(C)=O)cc2[C@@]2(O)O[C@H]([C@H](C)OC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C52H45FO13/c1-32(62-48(55)36-16-8-4-9-17-36)44-45(63-49(56)37-18-10-5-11-19-37)46(64-50(57)38-20-12-6-13-21-38)47(65-51(58)39-22-14-7-15-23-39)52(59,66-44)42-29-35(31-61-33(2)54)30-43(53)41(42)28-34-24-26-40(60-3)27-25-34/h4-27,29-30,32,44-47,59H,28,31H2,1-3H3/t32-,44+,45+,46-,47+,52+/m0/s1 |
| InChIKey | NNSXGFQRIGQFRW-VSABTDIMSA-N |
| XLogP | 7.95 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.92 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|