C18H19FO3 — CID 68987644
[4-[(4-ethylphenyl)methyl]-3-fluoro-5-hydroxyphenyl]methyl acetate (PubChem CID 68987644) has the molecular formula C18H19FO3 and a molecular weight of 302.35 g/mol. Its IUPAC name is [4-[(4-ethylphenyl)methyl]-3-fluoro-5-hydroxyphenyl]methyl acetate.
| Compound Name | [4-[(4-ethylphenyl)methyl]-3-fluoro-5-hydroxyphenyl]methyl acetate |
|---|---|
| PubChem CID | 68987644 |
| Molecular Formula | C18H19FO3 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [4-[(4-ethylphenyl)methyl]-3-fluoro-5-hydroxyphenyl]methyl acetate |
| SMILES | CCc1ccc(Cc2c(O)cc(COC(C)=O)cc2F)cc1 |
| InChI | InChI=1S/C18H19FO3/c1-3-13-4-6-14(7-5-13)8-16-17(19)9-15(10-18(16)21)11-22-12(2)20/h4-7,9-10,21H,3,8,11H2,1-2H3 |
| InChIKey | GMGMCSLFRBITDH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |