C20H22O4 — CID 68986403
[4-[(4-cyclopropyloxyphenyl)methyl]-3-hydroxy-5-methylphenyl]methyl acetate (PubChem CID 68986403) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is [4-[(4-cyclopropyloxyphenyl)methyl]-3-hydroxy-5-methylphenyl]methyl acetate.
| Compound Name | [4-[(4-cyclopropyloxyphenyl)methyl]-3-hydroxy-5-methylphenyl]methyl acetate |
|---|---|
| PubChem CID | 68986403 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [4-[(4-cyclopropyloxyphenyl)methyl]-3-hydroxy-5-methylphenyl]methyl acetate |
| SMILES | CC(=O)OCc1cc(C)c(Cc2ccc(OC3CC3)cc2)c(O)c1 |
| InChI | InChI=1S/C20H22O4/c1-13-9-16(12-23-14(2)21)11-20(22)19(13)10-15-3-5-17(6-4-15)24-18-7-8-18/h3-6,9,11,18,22H,7-8,10,12H2,1-2H3 |
| InChIKey | MLWYBQLJYMSHCW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |