C19H19FO4 — CID 68988840
[4-[(4-cyclopropyloxyphenyl)methyl]-3-fluoro-5-hydroxyphenyl]methyl acetate (PubChem CID 68988840) has the molecular formula C19H19FO4 and a molecular weight of 330.36 g/mol. Its IUPAC name is [4-[(4-cyclopropyloxyphenyl)methyl]-3-fluoro-5-hydroxyphenyl]methyl acetate.
| Compound Name | [4-[(4-cyclopropyloxyphenyl)methyl]-3-fluoro-5-hydroxyphenyl]methyl acetate |
|---|---|
| PubChem CID | 68988840 |
| Molecular Formula | C19H19FO4 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [4-[(4-cyclopropyloxyphenyl)methyl]-3-fluoro-5-hydroxyphenyl]methyl acetate |
| SMILES | CC(=O)OCc1cc(O)c(Cc2ccc(OC3CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C19H19FO4/c1-12(21)23-11-14-9-18(20)17(19(22)10-14)8-13-2-4-15(5-3-13)24-16-6-7-16/h2-5,9-10,16,22H,6-8,11H2,1H3 |
| InChIKey | MPHNKUIKSUGIKZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |