About [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate
[4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate (PubChem CID 59656939) has the molecular formula C15H21NO4
and a molecular weight of 279.34 g/mol. Its IUPAC name is [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate.
Molecular Properties
| Compound Name | [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate |
| PubChem CID | 59656939 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate |
| SMILES | CNC(C)C(=O)Oc1c(C)cc(COC(C)=O)cc1C |
| InChI | InChI=1S/C15H21NO4/c1-9-6-13(8-19-12(4)17)7-10(2)14(9)20-15(18)11(3)16-5/h6-7,11,16H,8H2,1-5H3 |
| InChIKey | WPHXVJRZLWOONW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate?
The IUPAC name of [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate (CID 59656939) is [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate.
What is the SMILES notation for [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate?
The canonical SMILES for [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate is CNC(C)C(=O)Oc1c(C)cc(COC(C)=O)cc1C.
What is the InChIKey of [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate?
The InChIKey is WPHXVJRZLWOONW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-9-6-13(8-19-12(4)17)7-10(2)14(9)20-15(18)11(3)16-5/h6-7,11,16H,8H2,1-5H3.
What are the key properties of [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate?
[4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate has a molecular weight of 279.34 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(acetyloxymethyl)-2,6-dimethylphenyl] 2-(methylamino)propanoate is sourced from PubChem (CID 59656939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).